icon

IndexesDownload


Sum formulas

Exact chemical meaning

Ag
AgpH
Agsolute-volatilization interference in flame spectroscopy
Ag+interfering substance in electroanalytical chemistry
AgBr
AgBrmolecular rearrangement
AgCl
AgClpH
AgClgravimetric method
AgI
β-AgIpolymorphic transition
AgIcrystalline electrodes
α-AgIpolymorphic transition
AgNO3
AgNO3gravimetric method
Ag2S
Ag2Scrystalline electrodes
Al
Alsolute-volatilization interference in flame spectroscopy
AlCl3
AlCl3ionization
AlNb3
Nb3Alsuperconducting transition
Al2
2Al3+mean activity of an electrolyte in solution
Al2MgO4
MgAl2O4solute-volatilization interference in flame spectroscopy
Ar
Ar+diamond by CVD
Argas-filled phototube
Arexcimer lamp
Ar+diamond-like carbon films
Arcryogenic sampling
ArPenning gas mixture
ArHOSe
ArSeOHselenenic acids
Ar2
Ar2excimer lamp
As
Asphotoconductive detector
Aspoison in catalysis
AsF5
AsF5dopant
AsH2
H2As+arsanylium ions
AsH2O
H2As(=O)+arsanylium ions
AsH2O2
HAs(OH)2arsonous acids
AsH3
AsH3arsines
AsH3arsanes
AsH3O
H2AsOHarsinous acids
H3As=Oarsine oxides
AsH3O2
AsH3O2arsinic acids
AsH3O3
AsH3O3arsonic acids
AsH4
(H4As+)onium compounds
AsH5
AsH5arsoranes
As3H5
H2AsAsHAsH2arsanes
As3H11
H4AsAsH3AsH4arsanes
Au
Audisproportionation
197Aunuclear quadrupole moment (spectroscopic)
AuFe
AuFespin-glass transition
B
Borganically modified silica
BH
HB+heteroconjugation
HB:carbene analogues
BH6N
H3N-->BH3dative bond
BN
N-->Bdative bond
B2BaO4
BaB2O4optical parametric oscillator
B2H
B–H–Belectron-deficient bond
B2H6
B2H6electron-deficient bond
B5H9
B5H9boranes
Ba
Ba2+mean activity of an electrolyte in solution
BaO3Ti
BaTiO3ferroelectric (antiferroelectric) transition
BiH3
BiH3bismuthines
BiH3bismuthanes
BiH4
(H4Bi+)onium compounds
Br
Brexcimer lamp
Brsulfonium compounds
Braddition reaction
Brtelomerization
Brfragmentation
Brmolecular rearrangement
Brallylic substitution reaction
Brleaving group
Br+halonium ions
BrH
BrHleaving group
BrH2
(H2Br+)onium compounds
BrKr
KrBrexcimer lamp
BrXe
XeBrexcimer lamp
C
Cmultiply labelled
Ctransferases
Cstrain energy
–C=heteroarenes
Corganically modified silica
13Cchemical shift, δ in NMR
Cpotential-energy (reaction) surface
Ctautomerism
Cdipolar compounds
Cmethylotrophic microorganisms
Chydrogen bond in theoretical organic chemistry
Crepulsive potential-energy surface
12Crelative micellar mass
12Cmolecular ion in mass spectrometry
Cspin polarization
CB
B–Cpotential-energy (reaction) surface
BCrepulsive potential-energy surface
CBrCl3
CBrCl3telomerization
CBr4
CBr4rotator phase transition
CCaO3
CaCO3monotropic transition
CCl
C–Clcoordination
CClF3
CF3Clbackground concentration (level) in atmospheric chemistry
CCl2
:CCl2carbenes
CCl2α-addition (alpha-addition)
CCl2F2
CF2Cl2background concentration (level) in atmospheric chemistry
CCl3
Cl3Ccarbanion
CCl3telomerization
Cl3C.telomerization
Cl3C.chain transfer
CF
C–Fnegative hyper-conjugation
CH
CHstrain energy
CHagostic
C–Hsymbiosis
C–Hsteric isotope effect
HCcarbynes
CHbicycle-pedal (BP) mechanism
C–Hhypercoordination
C–Hpersistent
–CH=dipyrrins
CHcarbaboranes
–CH=quinones
C–Hσ, π (sigma, pi)
CHN
HC≡Nisocyanides
HN+≡Cisocyanides
C=NHimines
HC≡Nnitriles
HC≡Ncyanides
CHNO
HOC≡Nisocyanates
HN=C=Oisocyanates
HON=C:fulminates
HC≡N+–Ofulminates
HOC≡Ncyanates
CHNS
HSC≡Nthiocyanates
CHNSe
HSeCNselenocyanates
CHO
–CHOcharacteristic group in organic nomenclature
CHO2
–COOHcharacteristic group in organic nomenclature
–COOHpolyacid
CH2
CH2strain energy
H2Csilylene
CH2insertion
:CH2carbenes
H2C:carbenes
CH2homoconjugation
–CH2meso structures in polymers
H2C.+carbynium ions
H2C.+carbene radical cations
CH2tropyl radicals
CH2hypercoordination
–CH2pyrromethenes
CH2tropylium ions
H2C:alkylidenes
–CH2hydrocarbylene groups
CH2Cl
ClCH2organyl groups
CH2N2
CH2=N2diazo compounds
HN=C=NHcarbodiimides
CH2=N=Nisoelectronic
CH2Na2O4
Na2CO3·10H2Oefflorescence
CH2O
CHOHoxo compounds
CHOHprochirality
CH2Ofragmentation
CH2Osmog chamber in atmospheric chemistry
CH3
CH3allylic intermediates
CH3dimerization
CH3colligation
CH3bond-dissociation energy, D
CH3+even-electron ion
CH3strain energy
CH3fragmentation
CH3chain reaction
.CH3radical (free radical)
CH3benzylic intermediates
CH3(2A'2)isogyric reaction
CH3abstraction
CH3σ, π (sigma, pi)
CH3Cl
CH3Clmolecular rearrangement
CH3Clsubstitution reaction
CH3ClO2S
CH3ClO2Sacyl halides
CH3F
CH3Fmolecular laser
CH3I
CH3Iidentity reaction
CH3IMg
MeMgIorganometallic compounds
CH3N
CH3N:carbene analogues
CH3N:nitrenes
CH3NO2
CH3NO2azinic acids
CH3NO2carbamates
CH3NO2S
CH3N=S(=O)2sulfonylamines
CH3NaS
CH3SNa+thiolates
CH3O
–CH2OHuronic acids
CH3O+oxylium ions
OCH3π-electron acceptor/donor group
CH3S
CH3–S–sulfenyl groups
CH3S+sulfenylium ions
MeS–organyl groups
CH3S.sulfenyl radicals
CH4
CH4multiply labelled
CH4reduced species
CH4molecular entity
CH4stoichiometry
CH4bond energy (mean bond energy)
CH4composition of pure air in atmospheric chemistry
CH4(1A1)isogyric reaction
CH4isotopologue
13CH4+isotope pattern in mass spectrometry
CH4isotope pattern in mass spectrometry
12CH4+isotope pattern in mass spectrometry
CH4spectator mechanism
CH4symbiosis
CH4bond-dissociation energy, D
CH4abstraction
CH4FN
CH4FNnegative hyper-conjugation
CH4N2O
CH4N2Oisoureas
CH4N4
H2NN=CHN=NHformazans
CH4O
CH3OHBrønsted acid
(CH3OH2+)lyonium ion
CH4Osubstitution reaction
CH4Oline formula
CH4Ooxidative coupling
CH4Oα-addition (alpha-addition)
CH3OHamphiprotic (solvent)
CH4O4
C(OH)4ortho acids
CH4Si
H2Si=CH2heteroalkenes
CH5
CH5+coordination number
+CH5alkanium ions
CH5B
CH5Bspectator mechanism
CH5N3O
NH2NHC(=O)NH2semicarbazones
CH5P
CH3PH2phosphines
CIN
ICNpseudohalogens
CKN
KCNorder-disorder transition
CKNO
KOCNcyanates
CN
CNapicophilicity
CNinterfering substance in electroanalytical chemistry
–C≡Ncharacteristic group in organic nomenclature
C–Nlyases
CNprochirality
CNorder-disorder transition
CNpseudohalogens
–CNcarbonitriles
C–Nhydrolases
C–Nligases (synthetases)
CNNa
NaCNcyanides
CNNaO
Na+[–C≡N+O]fulminates
CNO
–NCOcharacteristic group in organic nomenclature
CNS
N≡C–Sorganoheteryl groups
SCNpseudohalogens
CNS2
(SCN)2pseudohalogens
CO
C=Ocarbonyl compounds
C=Ooxo compounds
COphotodecarbonylation
COisoelectronic
COoxocarbons
COair pollutant
C–Olyases
C–Ohydrolases
C–Oligases (synthetases)
–C(=O)–quinones
CO2
CO2sublimation
CO2laser
CO2reduced species
CO2photodecarboxylation
CO2photophosphorylation
CO2molecular laser
CO2composition of pure air in atmospheric chemistry
O=C=Oheterocumulenes
CO2acid rain in atmospheric chemistry
O=C=Ooxocarbons
CO2cryogenic sampling
CO2sanitary land fill
CO2photosynthesis
CO2greenhouse effect in atmospheric chemistry
CO2carbon dioxide laser (CO2 laser)
CS
C–Sligases (synthetases)
CY
C–Ybisecting conformation (eclipsing conformation)
C2
C–Clyases
C–Ceclipsing strain
C–Corbital symmetry
C–Chydrolases
C–Cligases (synthetases)
C–Cphotohydration
C–Csymbiosis
C2H
HC≡Ccarbanion
C2HNa
NaC≡CHacetylides
C2H2
H2C=C:carbenes
H2C=C:vinylidenes
–CH=CH–heteroarenes
C2H2flow rate in flame emission and absorption spectrometry
C2H2local fraction atomized, χ a, β a in flame emission and absorption spectrometry
C2H2O
CH2=C=Oheterocumulenes
CH2=C=Oisoelectronic
C2H3
CH2=CH–vinylic groups
C2H3AgO2
C2H3AgO2molecular rearrangement
C2H3Cl
C2H3Clisodesmic reaction
:Cl–CH=CH2conjugated system (conjugation)
C2H3ClO
C2H3ClOacyl halides
C2H3Cl3
C2H3Cl3isodesmic reaction
C2H3N
CH3C≡Ncyanides
C2H3NS
CH3SC≡Nthiocyanates
C2H3O
CH3C(=O)–organyl groups
C2H3O2
–CH2CO2Hprochirality
C2H3O2ionization
C2H3O2proton transfer reaction
CH3CO2Brønsted base
C2H3O2nucleophilic catalysis
C2H4
C2H4disproportionation
C2H4de Mayo reaction
C2H4isodesmic reaction
C2H4attachment
–CH2–CH2meso structures in polymers
C2H4ene reaction
C2H4sorptive insertion in surface catalysis
+CH2+CH2dicarbenium ions
C2H4hydration
C2H4reactive adsorption
C2H4negative hyper-conjugation
C2H4hyperconjugation
C2H4sudden polarization
C2H4Cl2
C2H4Cl2isodesmic reaction
C2H4Cl2NO
C2H4Cl2NOaminoxyl radicals
(ClCH2)2N–O.nitroxides
C2H4Cl2O
C2H4Cl2Oα-addition (alpha-addition)
C2H4Cl3Pt
[PtCl3(CH2=CH2)]chelation
C2H4F
C2H4Fnegative hyper-conjugation
C2H4Fhyperconjugation
C2H4N
CH3–CH=N.iminyl radicals
C2H4O
C2H4Ostoichiometry
C2H4O2
C2H4O2ionization
CH3CO2HBrønsted acid
C2H4O2nucleophilic catalysis
CH3CO2Hprochirality
C2H4O2proton transfer reaction
C2H4O2leaving group
C2H4O2catalytic hydrogenolysis
C2H4O3
CH3C(=O)OOHper acids
CH3C(=O)OOHperoxy acids
C2H5
CH3CH2+carbenium ion
C2H5disproportionation
CH3CH2organyl groups
C2H5Br
13CCH5Br+.isotopic molecular ion
13C2H581Br+.isotopic molecular ion
C2H581Br+.isotopic molecular ion
C2H579Brmolecular ion in mass spectrometry
C2H5BrO
BrCH2CH2OHhalohydrins
C2H5Cl
C2H5Clnucleophile (nucleophilic)
C2H5N
MeN=CH2heteroalkenes
C2H5NO2
H3N+CH2C(=O)Ozwitterionic compounds/zwitterions
C2H5N3O2
H2NNHC(=O)C(=O)NH2semioxamazones
C2H6
C2H6disproportionation
C2H6catalytic hydrogenolysis
C2H6dimerization
C2H6pseudorotation
CH313CH3principal ion in mass spectrometry
C2H6CuLi
Li+[CuMe2]organometallic compounds
C2H6NO
C2H6NOaminoxides
C2H6N2
C2H6N2carboxamidines
C2H6N2isoelectronic
C2H6N4S2
H2NC(=NH)SSC(=NH)NH2formamidine disulfides
C2H6O
CH3–CH[2H]–OHsingly labelled
CH3CH2OHconstitutional isomerism
CH3OCH3constitutional isomerism
CH3CH2OHprochirality
CH3–CH2–[18O][2H]mixed labelled
C2H6Ohydration
C2H6O2
HOCH2CH2OHglycols
C2H6S
MeCH2SHthiols
C2H7
[C2H7]+alkanium ions
C2H7As
CH3CH2AsH2arsines
C2H7AsO2
C2H7AsO2arsinic acids
C2H7NS
CH3CH2SNH2amides
C2H5SNH2sulfenamides
C2H7S
(CH3)2S+Honium compounds
C2H10O3Si3
C2H10O3Si3cyclosiloxanes
C2N
(CN)2pseudohalogens
C3
C=C=Cchirality axis
C3H2
c-(CH2)3homodesmotic reaction
C3H3AsO
(CH3)3As=Oarsine oxides
C3H3Bi
(CH3)3Bibismuthines
C3H3N
CH2=CH–C≡Nconjugated system (conjugation)
C3H4
H2C=CHCH:carbenes
H2C=CHC:Hvinyl carbenes
C3H4O2
C3H4O2de Mayo reaction
C3H5
H2C=CHCH2+allylic intermediates
C3H5delocalization
CH3CH2Calkylidynes
CH2=CHCH2allylic groups
C3H5NO
C3H5NOlactams
HOCH2CH2C≡Ncyanohydrins
C3H5NO3
C3H5NO3amic acids
C3H5NO3S
C3H5NO3Simides
C3H5NSe
CH3CH2SeCNselenocyanates
C3H5O
C3H5Ocontributing structure
C3H5Oabstraction
C3H6
+CH2CH2+CH2dicarbenium ions
C3H6.+radical ion
C3H6corrinoids (cobalamines, corphyrins, corrins, vitamin B12 compounds)
H2C.–CH2–C.H2diradicals
CH3CH2CH:alkylidenes
–CH2CH2CH2hydrocarbylene groups
C3H6ene reaction
C3H6O
C3H6Oabstraction
C3H6Oepoxy compounds
C3H6Oproton transfer reaction
C3H6OPaterno–Büchi reaction
C3H6Oisoelectronic
C3H6Ofragmentation
C3H6Odimerization
C3H6S
CH3CH2C(=S)Hthioaldehydes
C3H7
CH3CH2CH2+carbenium ion
CH3CH2C.H2alkyl radicals
C3H7Br
C3H7Brmolecular rearrangement
C3H7ClO
ClCH2CH2CH2OHhalohydrins
C3H7N
EtCH=NHaldimines
C3H7O
C3H7Ofragmentation
C3H7Oproton transfer reaction
C3H8
C3H8catalytic hydrogenolysis
C3H8O2S
(CH3)2CHS(=O)OHsulfinic acids
C2H5S(=O)2CH3sulfones
C3H9ClP
Cl(CH3)3P+onium compounds
C3H9ClS
[(CH3)3S]+Clsulfonium compounds
C3H9N
C3H9Nammoniumyl radical ions
NMe3leaving group
C3H9Nleaving group
C3H9NO
(CH3)3N+–Ozwitterionic compounds/zwitterions
C3H9NO2S
C3H9NO2Samides
C3O2
O=C=C=C=Oheterocumulenes
O=C=C=C=Ooxocarbons
C4H4
3 CH2=CH2homodesmotic reaction
C4H4N2
C4H4N2pyrimidine bases
C4H4N2heteroarenes
C4H4O2
HO[CH2]4OHglycols
C4H4O2isolated double bonds
C4H4S
C4H4Sheteroarenes
C4H5N
C4H5Nindicated hydrogen
C4H5NO2
C4H5NO2imides
C4H6
C4H6attachment
C4H6non-Kekulé molecules
C4H6addition reaction
CH2=C(C.H2)2trimethylenemethanes
CH3–CH=C=CH2dienes
CH2=CH–CH=CH2dienes
CH2=CH–CH=CH2conjugated system (conjugation)
3 CH3–CH3homodesmotic reaction
C4H6cheletropic reaction
C4H6s-cis, s-trans
C4H6Br2
C4H6Br2addition reaction
C4H6O
C4H6Ooxa-di-π-methane rearrangement
C4H6O2S
C4H6O2Scheletropic reaction
C4H6O3
C4H6O3acid anhydrides
C4H6O3nucleophilic catalysis
C4H6O4
C4H6O4oxidative coupling
C4H6O6
C4H6O6meso-compound
C4H7Br
C4H7Brallylic substitution reaction
C4H7ClO2Zn
ClZnCH2C(=O)OEtorganometallic compounds
C4H7NO
(CH3)2C(OH)C≡Ncyanohydrins
C4H7Y
C4H7Ychain polymerization
C4H8
C4H8addition reaction
C4H8cycloalkanes
C4H8anti
C4H8hyperconjugation
C4H8Br2
C4H8Br2anti
C4H8O
C4H8Omultiply labelled
CH3CH2COCH3prochirality
C4H8Oallylic substitution reaction
C4H8S
CH3C(=S)CH2CH3thioketones
C4H9
C4H9hyperconjugation
C4H9Br
C4H9Braddition reaction
C4H9FO
C4H9FOdiastereotopic
C4H9N
C4H9Npre-equilibrium (prior equilibrium)
C4H9O
C4H9Ofragmentation
C4H10
C4H10catalytic hydrogenolysis
C4H10Mg
Et2Mgorganometallic compounds
C4H10N
C4H10Npre-equilibrium (prior equilibrium)
C4H10O
C4H10Ofragmentation
CH3CH2OCH2CH3ethers
CH3CH2CHOHCH3prochirality
C4H10Odiastereotopic
CH3CHOHCH2CH3prochirality
C4H10O3
HC(OCH3)3ortho esters
C4H11N
(CH3)3N+–CH2ylides
C4H11NO
C4H11NOpre-equilibrium (prior equilibrium)
C4H11O3PS
C4H11O3PSbetaines
C4H12N2
C4H12N2amine imides
C4H13NO
[(CH3)4N]+OHquaternary ammonium compounds
C4O4
C4O4oxocarbons
C5
C5terpenes
C5H3BrN4
C5H3BrN4tele-substitution
C5H4
C5H4nonclassical structure
C5H4electrocyclic reaction
C5H4N2O
C5H4N2Otopomerization
C5H4N4
C5H4N4purine bases
C5H5N
C5H5N+organoheteryl groups
C5H5Nnucleophilic catalysis
C5H5NO
C5H5NOtautomerism
C5H5NOS
C5H5NOSpenems
C5H5N5
C5H5N5tele-substitution
C5H5OP
C5H5OPindicated hydrogen
C5H5P
C5H5Pindicated hydrogen
C5H7NOS
C5H7NOSpenams
C5H7O2
C5H7O2carbanion
C5H8
C5H8di-π-methane rearrangement
3 CH3CH2CH3homodesmotic reaction
C5H8sigmatropic rearrangement
[CH2=C(CH3)CH=CH2]terpenes
C5H8OS2
CH3C(=O)SC(=S)CH2CH3thioanhydrides
C5H8O2
C5H8O2de Mayo reaction
C5H8O3
HC(=O)CH2CH2CH2C(=O)OHoxo carboxylic acids
C5H8O5
HO2CCH2CHOHCH2CO2Hprochirality
C5H8O7
C5H8O7pseudo-asymmetric carbon atom
C5H9Br
C5H9Brmolecular rearrangement
C5H9N
C5H9Naza-di-π-methane rearrangement
C5H9NO2
C5H9NO2imino acids
C5H9O
C5H9Oambident
C5H10
C5H10envelope conformation
C5H10ene reaction
C5H10O
C5H10Oprochirality
C5H10Omolecular rearrangement
C5H10O2
C5H10O2molecular rearrangement
C5H10O4
C5H10O4monosaccharides
C5H11NO2
C5H11NO2betaines
C5H12
Me4Csymbiosis
C5H12O4
C(OCH3)4ortho esters
C5H12O5
C5H12O5meso-compound
C5H14NO4P
Me3N+–CH2CH2–OP(=O)(OH)Ophospho
C5H15Ta
TaMe5homoleptic
C6H4
C6H4aryne
C6H4NS2
C6H4NS2Herz compounds
C6H4O2
C6H4O2quinones
C6H4O2quinhydrones
C6H5
C6H5aryl cations
C6H5AsCa
CaAsPharsenides
C6H5I
C6H5Iisotopic scrambling
C6H5KN2O
PhN=NOK+diazoates
C6H5NO2
C6H5NO2electrophile (electrophilic)
C6H5N2
C6H5N2isotopic scrambling
PhN+≡Ndiazonium salts
C6H5N3
PhN3azides
C6H5Y
C6H5YHammett equation (Hammett relation)
C6H6
C6H62+nonclassical structure
C6H6Kekulé structure (for aromatic compounds)
C6H6electrophile (electrophilic)
C6H6catalytic hydrogenolysis
C6H6homodesmotic reaction
3 CH2=CH–CH=CH2homodesmotic reaction
C6H6fulvenes
C6H6.radical ion
C6H6.+radical ion
C6H6NNa
C6H6NNaanilides
C6H6N2
C6H6N2quinonimines (quinone imines)
C6H6N2O
PhN=NOHdiazoates
C6H6O
C6H6Ovalence tautomerization
C6H6Oarene epoxides
C6H6OS
PhSOHsulfenic acids
C6H6O2
C6H6O2quinhydrones
C6H6O4
C6H6O4cycloaddition
C6H6O4S
PhS(=O)2OOHperoxy acids
C6H7
C6H7+arenium ions
C6H7N
C6H5NH2transformation
C6H7Nisotopic scrambling
C6H7Nammoniumyl radical ions
C6H8
C6H8electrocyclic reaction
C6H8NO2P
C6H8NO2Pamides
C6H8N2S
PhS(=NH)NH2sulfinamidines
C6H9Br
C6H9Branti
C6H9NOS
C6H9NOScephams
C6H9N3O2
C6H9N3O2pros in histidine nomenclature
C6H9Sb
(CH2=CH)3Sbstibines
C6H10
C6H10degenerate rearrangement
C6H10half-chair
C6H10attachment
C6H10carbenes
C6H10BrF
C6H10BrFanti
C6H10Br2NiP2
Ni[(CH3)2PCH2CH2P(CH3)2]Br2κ (kappa) in inorganic nomenclature
C6H10O3
C6H10O3tautomerism
C6H10O4
C6H10O4enoses
C6H10O7
C6H10O7uronic acids
C6H10O7ketoaldonic acids
C6H11BrO5
C6H11BrO5anomeric effect
C6H11NO
C6H11NOprochirality
C6H11NOlactams
C6H11S
C6H11Ssulfonium compounds
C6H12
C6H12oxidative addition
C6H12chair, boat, twist
C6H12Paterno–Büchi reaction
C6H12cyclo-
C6H12O2
C6H12O2dimerization
C6H12O3
C6H12O3acetonides
C6H12O5
C6H12O5α (alpha), β (beta)
C6H12O6
C6H12O6aldoses
C6H12O6Haworth representation
C6H12O6ketoses
C6H12O6α (alpha), β (beta)
C6H12O7
C6H12O7aldonic acids
C6H12Si
C6H12Sidi-π-silane rearrangement
C6H13NO5
C6H13NO5amino sugars
C6H14
C6H14cyclo-
C6H14LiN
C6H14LiNamides
C6H14N
C6H14Nabstraction
C6H14O6
C6H14O6Haworth representation
C6H15B
Et3Borganometallic compounds
C6H15N
C6H15Nabstraction
C6N4
C6N4π-adduct
C7H4ClO2
C7H4ClO2isodesmic reaction
C7H4O3S2
C7H4O3S2cyclic acid anhydrides (cyclic anhydrides)
C7H5ClO2
C7H5ClO2isodesmic reaction
C7H5NO
PhOCNcyanates
C7H5O2
C7H5O2isodesmic reaction
C7H6
C7H6annulenylidenes
C7H6FeO2S
[Fe(CO)3(C4H6SO)]η (eta or hapto) in inorganic nomenclature
C7H6N
C7H6Nnitrilium ions
C7H6O
C7H6Oquinomethanes
C7H6Otropones
C7H6OS
PhC(=S=O)Hsulfines
C7H6O2
C7H6O2isodesmic reaction
C7H6O2tropolones
C7H7
C7H7common-ion effect (on rates)
C7H7benzylic intermediates
(C7H72+)mass-to-charge ratio, m z in mass spectrometry
C7H7+tropylium ions
C7H7hyperconjugation
C7H7Br
C7H7Brleaving group
C7H7BrO
C7H7BrOcine-substitution
C7H7Cl
C7H7Clcommon-ion effect (on rates)
C7H7NO
C7H7NOamides
C7H7NS
PhC(=S)NH2thio
C7H8
C7H8cycloaddition
C7H8catalytic hydrogenolysis
C7H8hyperconjugation
C7H8tropilidenes
C7H8catalytic dehydrocyclization
C7H8NO
C7H8NOnucleophilic catalysis
C7H8O
C7H8Ocommon-ion effect (on rates)
C7H9N
C7H9Ncatalytic hydrogenolysis
C7H9NO
C7H9NOcine-substitution
C7H9NOS
PhS(=O)NHCH3sulfinamides
C7H9NO2S
PhS(=O)2NHCH3sulfonamides
C7H10BrF
C7H10BrFendo, exo, syn, anti
C7H12
C7H12anti
C7H12ClN
C7H12ClNacyl halides
C7H14N2
C7H14N2carboxamidines
C7H14O
C7H14ONorrish Type II photoreaction
C7H14O6
C7H14O6anomeric effect
C7H16
C7H16catalytic dehydrocyclization
C8H4O
C8H4Oheteroarynes
C8H5NO
C8H5NOcyanides
C8H6CrO
[Cr(CO)4(C4H6)]η (eta or hapto) in inorganic nomenclature
C8H6S2
C8H6S2isolated double bonds
C8H8
C8H8chain reaction
C8H8non-Kekulé molecules
C8H8chain transfer
C8H8quinomethanes
C8H8alternant
C8H8polyhedranes
C8H8ClNO
C8H8ClNOmolecular rearrangement
C8H8O4
C8H8O4polyketides
C8H8O4S
C8H8O4Sacid anhydrides
C8H9
(C8H9+)homoaromatic
C8H9ClO
PhCH(OH)CH2Clhalohydrins
C8H9N
PhCH=NMealdimines
C8H9NO
C6H5NHCOCH3transformation
C8H9NOmolecular rearrangement
C8H9NOanilides
C8H10S
C8H10Sleaving group
C8H11ClO
C8H11ClOα (alpha), β (beta)
C8H11NOS
(CH3)2S(=O)=NPhsulfoximides
C8H12
C8H12electrocyclic reaction
C8H12propellanes
C8H12N
C8H12Naminium ions
C8H12O5
C8H12O5tautomerism
C8H14
C8H14planar chirality
C8H14O4
C8H14O4monosaccharides
C8H16
C8H16tub conformation
C8H16crown conformation
C8H16extrusion transformation
C8H16N2
C8H16N2extrusion transformation
C8H18
C8H18catalytic hydrogenolysis
C8H18O
C8H18Ozig-zag projection
C8H20N
(CH3CH2)4N+onium compounds
C8K
C8Kintercalation reaction
C9H5N
C9H5Nheteroarynes
C9H6O2
C9H6O2isocoumarins
C9H6O2coumarins
C9H8Cl3
C9H8Cl3chain transfer
C9H8N2
C9H8N2dipyrrins
C9H10O
C9H10Omolecular rearrangement
C9H10O2
C9H10O2leaving group
C9H10O2catalytic hydrogenolysis
C9H12
C9H12π-adduct
C9H12S
(CH3)2S=CHPhylides
(CH3)2S+–CHPhylides
C9H14
C9H14Bredt's rule
C9H14O4
C9H14O4tautomerism
C9H16
C9H16spiro compounds
C9H16O2
C9H16O2tritactic polymer
C9H18O
C9H18OPaterno–Büchi reaction
C9H19NO4
C9H19NO4glycosylamines
C10
C10monoterpenoids
C10terpenes
C10H6
C10H6dehydroarenes
C10H8
C10H8fulvalenes
C10H8alternant
C10H8O
C10H8Ophenols
C10H10
C10H10non-Kekulé molecules
C10H10polyquinanes (polyquinenes)
C10H14NO
C10H14NOamidium ions
C10H15NS
(C2H5)2S=NPhsulfimides
C10H16
C10H16electrocyclic reaction
C10H16ring assembly
C10H18
C10H18cis-trans isomers
C10H20
C10H20iridoids
C11H6O3
C11H6O3furocoumarins
C11H12O4
C11H12O4acylals
C11H14
C11H14hula-twist (HT) mechanism
C11H14bicycle-pedal (BP) mechanism
C12H8
C12H8ring assembly
C12H8Cl2
C12H8Cl2meso-compound
C12H10
C12H10ring assembly
C12H10N2
PhN=NPhazo compounds
C12H10N2O
C12H10N2Oazoxy compounds
C12H10OS
Ph2S=Osulfoxides
C12H10O5S2
PhS(=O)2OS(=O)2Phsulfonic anhydrides
C12H12N2S
Ph2S(=NH)2sulfonediimines
C12H14
C12H14anti
C12H24O6
C12H24O6crown
C12O9
C12O9oxocarbons
C13H10O
Ph2C–O.radical ion
C13H12O2
C13H12O2bisphenols
C13H13N3
PhN=N–NPhMediazoamino compounds
C13H13OP
(Ph)2POCH3esters
C13H14
C13H14spiro compounds
C13H14O4
C13H14O4cycloaddition
C13H16O7
C13H16O7glycosides
C14H10
C14H10quinarenes
C14H10acenes
C14H10O
C14H10Oepoxy compounds
C14H10OS2
C14H10OS2acid anhydrides
C14H10O9
C14H10O9depsides
C14H12
C14H12cycloaddition
C14H12N6O3
C14H12N6O3folates
C14H24
C14H24propellanes
C15
C15sesquiterpenoids
C15terpenes
C15H10O2
C15H10O2flavonoids (isoflavonoids and neoflavonoids)
C15H11O
C15H11Oanthocyanidins
C15H16N
(p-Me2NC6H4)2CHPhleuco bases
C16H10
C16H10ortho- and peri-fused (polycyclic compounds)
C16H14O
PhC(=O)CH=C(CH3)Phdypnones
C16H16
C16H16cyclophanes
C17H16Cl3
C17H16Cl3chain transfer
C17H21NO4
C17H21NO4pseudo-asymmetric carbon atom
C17H21N2
C17H21N2cyanine dyes
C17H28
C17H28steroids
C18H12
C18H12ortho-fused (polycyclic compounds)
C18H14
C18H14quinarenes
C18H34O9
C18H34O9in-out isomerism
C18H36N2O6
C18H36N2O6cryptand
C19H12
C19H12ortho- and peri-fused (polycyclic compounds)
C19H14N4
C19H14N4tetrapyrroles
C19H14O5S
C19H14O5Ssulfonphthaleins
C19H15
C19H15fragmentation
C19H16
C19H16bicycle rearrangement
C19H17P
Ph3P+–CH2ylides
Ph3P+=CH2ylides
C19H22N4
C19H22N4corrinoids (cobalamines, corphyrins, corrins, vitamin B12 compounds)
C19H30
C19H30cyclo-
C19H32
C19H32cyclo-
C19H32abeo-
C19H32seco-
C19H32O
C19H32Oα (alpha), β (beta)
C19H34
C19H34seco-
C20
C20prostaglandins
C20leukotrienes
C20terpenes
C20diterpenoids
C20icosanoids
C20H12O5
C20H12O5xanthene dyes
C20H14N4
C20H14N4porphyrins
C20H14O4
C20H14O4phthaleins
C20H16O2
C20H16O2fragmentation
C20H19OP
C20H19OPbetaines
C20H20O5
C20H20O5lignans
C20H38O2
C20H38O2prostaglandins
C22H23ClN2O8
C22H23ClN2O8tetracyclines
C22H26O6
C22H26O6lignans
C23H22O6
C23H22O6rotenoids
C25
C25terpenes
C25sesterterpenoids
C26H16
C26H16helicenes
C26H16helicity
C27H54N2
C27H54N2in-out isomerism
C30
C30terpenes
C30triterpenoids
C30H42O
C30H42Ocarotenoids
C38H24Cl4
C38H24Cl4biradical
C40
C40terpenes
C40carotenoids
C40tetraterpenoids
C40H56
C40H56retro
C40H56carotenoids
C40H56O2
C40H56O2carotenoids
C41H29NO
C41H29NODimroth–Reichardt E T parameter
Ca
Ca2+interfering substance in electroanalytical chemistry
Ca2+selectivity coefficient, k A / B in ion exchange chromatography
Ca2+ionic conductivity
CaFeO3
CaFeO3disproportionation
Cd
Cdresonance lamp
CdHe
HeCdion laser
CdHgTe
HgCdTephotoconductive detector
CdS
CdSpressure-induced transition
CdSphotoconductive detector
Cl
Clabstraction
ClpH
Clapicophilicity
–Clcharacteristic group in organic nomenclature
Clgas sensing electrode
Clnucleofuge
ClHerz compounds
Clchain reaction
ClBrønsted base
Clsubstitution reaction
Cl.chain reaction
Clexcimer lamp
Clselectivity coefficient, k A / B in ion exchange chromatography
Clnucleophile (nucleophilic)
Cl.radical (free radical)
Clcommon-ion effect (on rates)
Cl+halonium ions
Clionization
Clgravimetric method
Clphotolysis
Clconjugate acid–base pair
ClCs
CsClthermally-induced transition
CsClstructural transition
CsClfirst-order phase transition
CsCldilational (dilatational) transition
ClH
HCloxoacids
ClHreaction path degeneracy
HClBrønsted acid
ClHisotope exchange
ClHmolecular rearrangement
HCllevelling effect
ClHabstraction
HClinternal filling solution of a glass electrode
HClconjugate acid–base pair
ClHO
HOCloxoacids
ClHO4
HClO4levelling effect
ClH2
(H2Cl+)onium compounds
ClH4N
NH4Clstructural transition
ClK
KClmembrane emf
KClDonnan emf (Donnan potential)
ClKr
KrClexcimer lamp
ClLiO4
LiClO4special salt effect
ClNa
NaClpressure-induced transition
NaClthermally-induced transition
NaClstructural transition
NaClfirst-order phase transition
ClXe
XeClexcimer lamp
XeClexcimer laser
Cl2
Cl2gas sensing electrode
Cl2polarizability
2Clmean activity of an electrolyte in solution
Cl2excimer lamp
Cl2F
(Cl2F+)onium compounds
Cl2Zn
ZnCl2activated carbon
Cl4Rb2Zn
Rb2ZnCl4commensurate–incommensurate transition
Co
Co3+spin-state transition
CoLaO3
LaCoO3spin-state transition
Cr
Cr3+solid state lasers
Cr3+ruby laser
Cu
CuPenning gas mixture
CuI
CuIchelation
CuMn
CuMnspin-glass transition
CuZn
CuZnsecond-order transition
F
Fapicophilicity
Fnegative hyper-conjugation
Fhydrogen bond
Fexcimer lamp
Fbranching ratio
F+halonium ions
Fhyperconjugation
FH
HFmolecular laser
HFsuperacid
HFchemical laser
HFbranching ratio
FHO3S
HSO3Fsuperacid
FH2
(H2F+)onium compounds
FKr
KrFexcimer laser
KrFliquid ion laser
F2P
Fap–P–Faphypervalency
F5P
PF5hypervalency
PF5polytopal rearrangement
F5Sb
SbF5superacid
F6S
SF6air mass in atmospheric chemistry
F6U
UF6gaseous diffusion separator in atmospheric chemistry
Fe
Fe3+Verwey transition
Fe2+Verwey transition
Feexchange-inversion transition
Fe3+order-disorder transition
Fe2+Fenton reaction
Fe3+Fenton reaction
57Fequadrupole splitting in Mössbauer spectroscopy
Fe3+equivalent entity
Fe2+oxidized species
Fe3+oxidized species
Feoxidized species
57Fenuclear quadrupole moment (spectroscopic)
Fespin crossover
FeIIspin crossover
FeIIIsalt form of an ion exchanger
FeIIsalt form of an ion exchanger
FeLiO2
LiFeO2order-disorder transition
FeMo
MoFespin-glass transition
FeRh
FeRhexchange-inversion transition
Fe2O3
α-Fe2O3Morin transition
Fe3O4
Fe3+[Fe3+Fe2+]O4Verwey transition
H
Hhyperconjugation
H+leaving group
H+general acid–base catalysis
Hcarbene analogues
Hselenides
Hbismuthines
H+pH
Hselenoxides
Hoxime O-ethers
H+extraction (equilibrium) constant
Hnucleophilic catalysis
Hhydron
H+hydron
Hhydron
Hmultiply labelled
H+gas sensing electrode
2Hdeuterium
2Hdeuterium
2H+deuterium
Htautomerism
Hhydrogen
Hselones
H+electrofuge
Hurethanes (urethans)
Hextended Hammett equation
Hketones
Hketoximes
HSchiff bases (Schiff's bases)
Hhemiketals
Hsulfenyl radicals
H+isoionic
H+ligands
H+catalytic coefficient
Hhemiaminals
Hstibines
Htellurides
Hethers
1Hchemical shift, δ in NMR
2Hdeuteron
H+tautomerism
Hthioethers
Hdual substituent-parameter equation
Hazomethines
Hthioketone S-oxides
Hpseudo acids
Hbranching chain reaction
Himines
1Haromatic
3Helectron capture detector in gas chromatography
Halkyl groups
Hesters
Hsulfenylium ions
Htrioxides
Helectrophile (electrophilic)
H+protonation constant
Hpolysulfanes
Hnitrones
Hselenols
H+Rutherford backscattering (RBS)
Hsulfenic acids
H+specific acid–base catalysis
Hthioketones
Hdiazoamino compounds
Hbond energy (mean bond energy)
Hsulfenamides
Hbond-dissociation energy, D
H+equivalent entity
Hsilicones
Hgas-phase acidity
Hsulfenyl groups
HHammett equation (Hammett relation)
Hsulfoxides
Hgas-phase basicity
Hpolysulfides
Hhydrazides
Henols
Halkoxyamines
Hortho esters
Hphosphines
3H+tritium
3Htritium
3Htritium
1Hprotium
1H+protium
H+protium
Hacetals
Hselenenic acids
H+Haber–Weiss reaction
Harsines
Hreaction path degeneracy
Hthiohemiacetals
Hketals
Hfragmentation
Hthioacetals
Hsulfones
H(2S)isogyric reaction
Hthiols
Haddition reaction
Hspin polarization
Hhemiacetals
HBrønsted relation
Hketimines
H+standard hydrogen electrode
Hsulfides
Hcommon-ion effect (on rates)
HI
HIlevelling effect
HLi
HLitopochemical reaction
LiHoxidation state
HN
–NHanion exchanger
HN:carbene analogues
HN:nitrenes
NHsilasesquiazanes
–NH–silazanes
HNLewis acid
HN=imino acids
HNO
=NOHhydroximic acids
HNO2
HON=Ooxoacids
HONOsmog chamber in atmospheric chemistry
HNO3
HNO3smog chamber in atmospheric chemistry
HN3
–N=N–NH–azimines
HN3azides
HO
OH–anion exchanger
OHgeneral acid–base catalysis
–OHvinylic groups
–OHhydrazidines
HOallylic substitution reaction
–OHcharacteristic group in organic nomenclature
OHerythro structures in a polymer
OHisoionic
HOsubstitution reaction
OHcatalytic coefficient
–OHbenzylic groups
OHphosphoglycerides
OHFenton reaction
OHphosphoramides
HOanhydro bases
OHoxo compounds
–OHcresols
OHkinetic equivalence
OHspecific acid–base catalysis
HOpre-equilibrium (prior equilibrium)
–OHallylic groups
HO+oxylium ions
OHanilides
OHBrønsted base
–OHsulfenamides
HOdecay rate in atmospheric chemistry
–OHhydrazides
HO.alcohols
–OHalcohols
–OHhydroxamic acids
HOmolecular rearrangement
HOacyl species
HO.acyl species
HO+acyl species
OH.Fenton reaction
OH.Haber–Weiss reaction
OHHaber–Weiss reaction
HOcolligation
OHbranching chain reaction
HOsmog chamber in atmospheric chemistry
–OHperoxy acids
HO2
–OOHperoxy acids
HO3S
–SO3Hcharacteristic group in organic nomenclature
–SO3Hpolyacid
HO4S
HSO4Brønsted acid
HSO4Brønsted base
HSi
Si–Hagostic
SiHsilasesquiazanes
H2
H2pH
H2gas sensing electrode
H2catalytic hydrogenolysis
H2(1Σ+g)isogyric reaction
H2standard hydrogen electrode
H2I
(H2I+)onium compounds
H2KN
H2KNisotopic scrambling
H2N
NH2amides
–NH2characteristic group in organic nomenclature
NH2phosphoglycerides
H2N.aminyl radicals
(H2N:+)nitrenium ions
H2NO
H2N–Oaminoxides
H2N–O.nitroxides
–NHOHhydroxamic acids
H2NP
HP=NHphosphazenes
H2N2
=NNH2hydrazidines
H2NN:carbene analogues
–NHNH–hydrazo compounds
=NNH2hydrazones
HN=NHazo compounds
H2N2O
H2NNOnitrosamides
H2N2O2
O2NNH2nitramines
H2N2S
HN=S=NHsulfur diimides
H2O
H2Ooxenium ions
H2Ocommon-ion effect (on rates)
H2Oionization
H2Ocomposition of pure air in atmospheric chemistry
H2Otemperature lapse rate in atmospheric chemistry
H2OBrønsted acid
H2Osupersaturation
H2OBrønsted base
H2Ooxidative coupling
H2Onucleophilic catalysis
H2Oanhydro bases
H2Ohydration
H2Obranching chain reaction
H2Opre-equilibrium (prior equilibrium)
H2Ogaseous diffusion separator in atmospheric chemistry
H2OHaber–Weiss reaction
H2Osanitary land fill
H2Ophotosynthesis
H2Oamphiprotic (solvent)
H2O2
HOOHhydroperoxides
H2O2Fenton reaction
H2O2oxidation state
H2O2Haber–Weiss reaction
H2O2smog chamber in atmospheric chemistry
H2O2S
HOSOHoxoacids
HS(=O)OHsulfinic acids
H2O3
HOOOHtrioxides
H2O3P
–PO3H2characteristic group in organic nomenclature
–P(=O)(OH)2phospho
–P(=O)(OH)2phosphono
–PO3H2polyacid
H2O3S
HS(=O)2OHsulfonic acids
H2O4S
(HO)2SO2oxoacids
H2SO4reduced species
H2SO4Brønsted acid
H2SO4equivalent entity
H2SO4oxidation state
H2SO4haze in atmospheric chemistry
H2SO4amphoteric
H2S
H2Shydrocracking unit
H2Sreduced species
SH2bonding number
H2Ssulfenylium ions
H2Sacid-labile sulfur
H2Soxidized species
H2Ssulfenyl groups
H2Ssulfenyl radicals
H2Soxidation state
H2Ssulfanes
H2Sair pollutant
H2S2
HS2Hpolysulfanes
H2Se
H2Seselenides
H2Si
H2Si:silylene
H2Sisilylene
H2Te
H2Tetellurides
H3N
H3N.+ammoniumyl radical ions
H3Naminiumyl radical ions
NH3Brønsted acid
NH3Rydberg state
H3Ntele-substitution
H3NO
H2N–OHhydroxylamines
H3NO2
H3NO2azinic acids
H3NO3
H3NO3azonic acids
H3NO3S
H2NS(=O)2OHsulfamic acids
H3NS
H2S=NHsulfimides
H3N2
–NHNH2hydrazidines
H2NN.Hverdazyl radicals
H3N3
NH2N=NHtriazenes
H3O
H3O+oxonium ions
H3Oionization
H3O+Brønsted acid
(H3O+)onium compounds
H3OP
H2POHphosphinous acids
H3O2P
HP(OH)2phosphonous acids
H2P(=O)OHphosphinic acids
H3O3P
P(OH)3oxoacids
HP(=O)(OH)2phosphonic acids
H3O4P
H3PO4electrolytic hygrometer
H3P
PH3phosphines
PH3phosphanes
H3S
(H3S+)onium compounds
H3Sb
SbH3stibanes
SbH3stibines
H3Se
(H3Se+)onium compounds
H3Si
H3Si–silyl groups
H3Si.silyl radicals
H3Sn
.SnH3radical (free radical)
H3Te
(H3Te+)onium compounds
H4N
(H4N+)onium compounds
H4NP
H3P=NHphosphazenes
H4NY
(NH4+)Yquaternary ammonium compounds
H4N2
H2NNH2hydrazines
H4OSi
H3SiOHsilanols
H4P
(H4P+)onium compounds
H4Sb
(H4Sb+)onium compounds
H5NO4S
NH4HSO4haze in atmospheric chemistry
H5N3
NH2NHNH2triazanes
H5P
PH5phosphoranes
H6S
SH6bonding number
H10N2Si3
H3SiNHSiH2NHSiH3silazanes
He
3Hehelion
Heatomic laser
He+Rutherford backscattering (RBS)
4Heα-particle (alpha-particle)
Hg
Hgresonance lamp
I
Iidentity reaction
129Inuclear quadrupole moment (spectroscopic)
131Iradioiodination
125Iradioiodination
123Iradioiodination
Iexcimer lamp
I+halonium ions
IK
IKisotopic scrambling
IO2
IO2characteristic group in organic nomenclature
IXe
XeIexcimer lamp
I2
I2dopant
I2excimer lamp
K
Ksyntectic reaction
KMnO4
KMnO4equivalent entity
KZn
K-Znsyntectic reaction
KZn13
KZn13syntectic reaction
Kr
Krexcimer lamp
Krresonance lamp
Krliquid ion laser
Kr2
Kr2excimer lamp
La
La3+ionic conductivity
Li
Li+order-disorder transition
LiMn2O4
Li[Mn2]O4topochemical reaction
Mg
Mgsolute-volatilization interference in flame spectroscopy
Mg2+selectivity coefficient, k A / B in ion exchange chromatography
Mg2O4Si
Mg2SiO4reconstructive transition
MnO2
MnO2magnetic transition
Mn3O4
Mn3O4Jahn–Teller transition
N
Nimides
Nhydrogen bond in theoretical organic chemistry
Ndipolar compounds
Nhydrogen bond
Numpolung
≡Nnitriles
Namidium ions
Nalkoxyamines
Nspin crossover
NO
NOreference procedure in analysis of trace air constituents
–NOnitroso compounds
NOemission in atmospheric chemistry
NOcomposition of pure air in atmospheric chemistry
–N=Oisonitroso compounds
NO+isoelectronic
NOprimary pollutant in atmospheric chemistry
NO2
NO2reference procedure in analysis of trace air constituents
NO2+electrofuge
–NO2nitro compounds
NO2π-electron acceptor/donor group
NO2composition of pure air in atmospheric chemistry
NO2permeation tube
NO2air pollutant
NO2electrophile (electrophilic)
NO3
NO3mean activity of an electrolyte in solution
NO3oxidant in atmospheric chemistry
NO3Rb
RbNO3thermally-induced transition
N2
N2reference procedure in analysis of trace air constituents
N2cage
=N+=Ndiazo compounds
N2molecular laser
N2photochemical nitrogen extrusion
N2isoelectronic
N2cryogenic sampling
N2geminate recombination
N2O
N2Olocal fraction atomized, χ a, β a in flame emission and absorption spectrometry
N3
N3azides
–N=N+=Nazides
N3pseudohalogens
–N3quinone diazides
N3Na
NaN3azides
Na
Na+mean activity of an electrolyte in solution
Na+interfering substance in electroanalytical chemistry
Naresonance lamp
Na+ionic conductivity
Nb3Sn
Nb3Snsuperconducting transition
Ne
Nehelium–neon laser
Neatomic laser
Neexcimer lamp
Ni
63Nielectron capture detector in gas chromatography
NiS
NiSdilational (dilatational) transition
O
Oimides
=Ohydrazidines
–O–silathianes
=Ocharacteristic group in organic nomenclature
=Oimidines
–O–imidines
O2−ligands
=Ohydroximic acids
Odipolar compounds
Ohydrogen bond
Otautomerism
–O–diamidides
=Odiamidides
Ohydrogen bond in theoretical organic chemistry
–O–silazanes
=Ooxo compounds
Oumpolung
Oylides
Oamidium ions
=Ohydrazones
=Oimidic acids
Obranching chain reaction
OP
P–Oligases (synthetases)
O2
O2biochemical (biological) oxygen demand (BOD)
(=O)2sulfonediimines
O2singlet molecular oxygen (singlet molecular dioxygen)
O2spin-statistical factor (in diffusion-controlled reactions)
O2flow rate in flame emission and absorption spectrometry
O2mean free path, λ
O22−peroxides
O2catalase
O2chemical oxygen demand (COD)
O2chemical bond
O2Schenck-sensitization mechanism
O2Haber–Weiss reaction
O2Haber–Weiss reaction
O2photosynthesis
O2configuration (electronic)
O2S
SO2oxidized species
SO2extraction (equilibrium) constant
SO2emission in atmospheric chemistry
O2Scheletropic reaction
SO2primary pollutant in atmospheric chemistry
SO2oxidation state
SO2permeation tube
SO2composition of pure air in atmospheric chemistry
SO2sink in atmospheric chemistry
SO2air pollutant
O2Si
SiO2polymorphic transition
SiO2displacive transition
O2Ti
TiO2irreversible transition
O2V
VO2metal–insulator transition
O2Zr
ZrO2martensitic transition
O3
O3reference procedure in analysis of trace air constituents
O3secondary pollution (emissions)
O3decay rate in atmospheric chemistry
O3greenhouse effect in atmospheric chemistry
O3S
SO3oxidized species
SO3oxidation state
–(SO3)membrane sites in an ion-selective electrode
O3Ti2
Ti2O3semiconductor-metal transition
O4
O4chemical bond
O4S
SO42−Brønsted base
SO42−selectivity coefficient, k A / B in ion exchange chromatography
O4S3
3SO42−mean activity of an electrolyte in solution
O4Si
SiO4displacive transition
O5P2
P2O5electrolytic hygrometer
O5V2
V2O5gel
P
Pimides
Pumpolung
PbS
PbSphotoconductive detector
Pt
PtpH
Ptgas sensing electrode
S
Spolytypic transition
Simides
Stautomerism
Smustards
–S–silathianes
Shydrogen bond in theoretical organic chemistry
Sumpolung
Sylides
Spoison in catalysis
Striple point
SZn
ZnSpolytypic transition
S2
S2polysulfanes
S2Ti
TiS2intercalation reaction
S8
S8oxidation state
Se
Seimides
Seumpolung
Seylides
Si
Sidi-π-silane rearrangement
Sisilanols
Siphotoconductive detector
SiV3
V3Sisuperconducting transition
Sn
119Snnuclear quadrupole moment (spectroscopic)
119Snquadrupole splitting in Mössbauer spectroscopy
Te
Teimides
Teylides
Ti
Ti3+solid state lasers
U
239Uresonance neutrons
Xe
Xeexcimer lamp
Xeresonance lamp
Xe2
Xe2excimer lamp
Zn
Znpolytypic transition
Znsyntectic reaction
Znresonance lamp
picture