icon

IndexesDownload


Sum formulas

Without exact chemical meaning

.+radical ion
.radical ion
Aatom–molecule complex mechanism
ABrønsted relation
Acatalytic hydrogenolysis
Adimerization
Aelectron-transfer catalysis
Aheterolytic dissociative adsorption
Ahomolytic dissociative adsorption
Aisotopic fractionation factor
Akinetic isotope effect
Alight-atom anomaly
Apotential-energy (reaction) surface
Arepulsive potential-energy surface
ABrønsted relation
Aheteroconjugation
Ahomoconjugation
A.heterolytic bond-dissociation energy
A'Hheteroconjugation
A+heterolytic bond-dissociation energy
A+.electron-transfer catalysis
A1-xBxchemical diffusion
A2atom–molecule complex mechanism
A2dimerization
A–Bheterolytic bond-dissociation energy
A–Blight-atom anomaly
A–Bpotential-energy (reaction) surface
A–Brepulsive potential-energy surface
abC=C=Ccdchirality axis
abC=Cc2pro-E, pro-Z
AcOligands
AHhomoconjugation
AMatom–molecule complex mechanism
ArCR2benzylic groups
ArNRNRArhydrazo compounds
AsnHn+2arsanes
AsR3arsenides
Bcatalytic hydrogenolysis
Bconjugate acid–base pair
Belectron-transfer catalysis
Bheterolytic dissociative adsorption
Bhomoconjugation
Bhomolytic dissociative adsorption
Bionic conductivity
Bisotopic fractionation factor
Blight-atom anomaly
Bheterolytic bond-dissociation energy
B.heterolytic bond-dissociation energy
B'heteroconjugation
B+.electron-transfer catalysis
BClight-atom anomaly
BH+conjugate acid–base pair
BinHn+2bismuthanes
BuLiorganometallic compounds
Clight-atom anomaly
cpro-R, pro-S
C(OR')4ortho esters
C=Xbisecting conformation (eclipsing conformation)
C2H4DBr+.isotopic molecular ion
C5nterpenes
C6H5Zpartial rate factor
Cabcdchirality centre
CaCl2·nROHalcoholates
C–Dsteric isotope effect
CDCl3chemical shift, δ in NMR
Cesymmetry-conserving transition
[(CH)a(BH)mHb]ccarbaboranes
(CH)npolyhedranes
–[CH2]ncyclophanes
CH2D+isotopic ion
CH2D2isotopologue
CH2D2principal ion in mass spectrometry
CH2DCH=Oisotopomer
CH2DCO2Hprochirality
CH3(CH2)nCO2M+amphiphilic
CH3(CH2)nN+(CH3)3Xamphiphilic
CH3(CH2)nSO3M+amphiphilic
CH3CD=Oisotopomer
CH3CH=CHDisotopomer
CH3CHDOHisotopomer
CH3CHDOHprochirality
CH3CHOHCHDCH3prochirality
CH3Disotopologue
CHDTCO2Hprochirality
CHX3haloforms
Cl3C[CH2CHPh]nBrtelomerization
Cn(H2O)ncarbohydrates
CnH2nalkenes
–CnH2n+1alkyl groups
CnH2n+2alkanes
CnH2n-2alkynes
CnHnannulenes
CnHn+1annulenes
C–Rbisecting conformation (eclipsing conformation)
–CR2–CH2–CR2meso structures in polymers
–CR2–CR2O–crown
–CR2Hisonitroso compounds
Dorganically modified silica
D2Ochemical shift, δ in NMR
D2Ogaseous diffusion separator in atmospheric chemistry
D2Oheavy water
D2OpH
DFbranching ratio
DFchemical laser
DFmolecular laser
ΔEisostructural reaction
Er3+solid state lasers
[Fe(2-pic)3]Cl2·EtOHspin crossover
GdFeO3magnetic transition
GYcross-conjugation
H(CH2)nalkyl groups
H[CH(OH)]nC(=O)Haldoses
H–[CH2–C(CH3)=CH–CH2]n–OHdolichols
H–[CH2–C(CH3)=CH–CH2]n–OHpolyprenols
H–[CH2C(Me)=CHCH2]nOHprenols
H–[CHOH]n–C(=O)[CHOH]m–Hketoses
[(H2O)nH]+cluster ion in mass spectrometry
H3Si[OSiH2]nOSiH[OSiH2OSiH3]2siloxanes
H3Si[OSiH2]nOSiH3siloxanes
H3Si[SSiH2]nSSiH3silathianes
H3Sn[OSnH2]nOSnH3stannoxanes
HABrønsted relation
HAgeneral acid catalysis
HB+homoconjugation
HDbranching ratio
HDOgaseous diffusion separator in atmospheric chemistry
HDOheavy water
HLextraction (equilibrium) constant
HLaqextraction (equilibrium) constant
HnLprotonation constant
(HO)2P(=O)(OR)esters
[HOC(=NH2)NH2]+Xuronium salts
HOC(=O)[CH(OH)]nC(=O)OHaldaric acids
HOCH2[CH(OH)]nC(=O)OHaldonic acids
HOCH2[CH(OH)]nCH2OHalditols
HOCR'=CR2enols
HON=C{[CH2]n}2C=NOHE, Z
HSnHpolysulfanes
HTOgaseous diffusion separator in atmospheric chemistry
Lformation constant
Lisostructural reaction
Lprotonation constant
l'syntectic reaction
l''syntectic reaction
LixTiS2intercalation reaction
Malkoxides
Matom–molecule complex mechanism
Mdimeric ion in mass spectrometry
Mformation constant
Misostructural reaction
Mprotonated molecule in mass spectrometry
Msialon
Mcharge-transfer reaction in mass spectrometry
M+charge-transfer reaction in mass spectrometry
[M + H]+protonated molecule in mass spectrometry
[M2]+.dimeric ion in mass spectrometry
M2+charge-transfer reaction in mass spectrometry
MgX2Grignard reagents
MH+protonated molecule in mass spectrometry
MLnextraction (equilibrium) constant
MLnformation constant
MLnisostructural reaction
MLn-1Xisostructural reaction
Mnextraction (equilibrium) constant
M–Si–Al–O–Nsialon
N+abcdchirality centre
–N=CR2nitrile ylides
Nd3+neodymium laser
Nd3+solid state lasers
Ngexcimer lamp
Ng2excimer lamp
NHRamides
NnHn+2azanes
=NNR2hydrazonic acids
=NORhydroximic acids
=NRamidines
=NRdiamidides
=NRimidic acids
=NRimidines
=NRquinonimines (quinone imines)
NRimines
NRylides
–NR–diamidides
–NR–imidines
(=NR)2sulfonediimines
NR2amides
NR2glycosylamines
–NR2sulfenamides
–NRNR2hydrazides
O=NN=CR2nitrosimines
O2NN=CR2nitrimines
[–OSiR2–]nsilicones
O–Z–O.semiquinones
P(=O)(NR2)3phosphoramides
P(=O)(OH)(NR2)2phosphoramides
P(=O)(OH)2(NR2)phosphoramides
Pabcchirality centre
PhXselectivity factor, S f
PnHn+2phosphanes
+Rcross-conjugation
Racetals
Raldehydes
Ralkoxides
Ralkyl groups
Rarsines
Razomethines
Rbisecting conformation (eclipsing conformation)
Rbismuthines
Rcarbene analogues
Rdiazoamino compounds
Rdiazoates
Resters
Rethers
Rhemiaminals
Rhemiketals
Rhydrazides
Rhydroperoxides
Rhydropolysulfides
Rimines
Rketals
Rketimines
Rketones
Rketoximes
Rorganically modified silica
Rphosphines
Rpolysulfides
Rselenenic acids
Rselenides
Rselenols
Rselenoxides
Rselones
Rsilicones
Rsteric effect
Rstibines
Rsulfenamides
Rsulfenic acids
Rsulfenyl groups
Rsulfenylium ions
Rsulfenyl radicals
Rsulfides
Rsulfones
Rsulfoxides
Rtellurides
Rthioacetals
Rthioethers
Rthioketones
Rthioketone S-oxides
Rthiols
Rcommon-ion effect (on rates)
-Rcross-conjugation
R'acetals
R'alkoxyamines
R'carbamates
R'diazoamino compounds
R'enols
R'hemiacetals
R'imines
R'nitrones
R'ortho esters
R'oxime O-ethers
R'Schiff bases (Schiff's bases)
R'thioacetals
R'thiohemiacetals
R'trioxides
R'urethanes (urethans)
R'2C=NRimines
R'C(=O)(OR)esters
R'C(=O)(SR)esters
R'C(=S)(OR)esters
R'S(=O)2(OR)esters
(R'S)2C(=O)esters
R–[S]n–Rpolysulfides
R+attachment
R+common-ion effect (on rates)
R+ion pair return
R1E, Z
R1.α-cleavage (alpha-cleavage)
R1COOR2moiety
R1R2C(=C=C)n=CR3R4E, Z
R1R2C=CR3R4E, Z
R1R2C=NOHE, Z
R2E, Z
R2AsHarsines
R2BiHbismuthines
R2BOHborinic acids
R2C:alkylidenes
R2C.+carbene radical cations
R2C.–Oketyls
R2C.–OHketyls
R2C(OH)–(OH)R2pinacols
R2C(OH)NR2hemiaminals
R2C(OH)ORhemiketals
R2C(OH)OR'hemiacetals
R2C(OR')(SR')thioacetals
R2C(OR')NR2hemiaminals
R2C(OR')SHthiohemiacetals
R2C(OR)2ketals
R2C(SR')2thioacetals
R2C(SR')OHthiohemiacetals
R2C(SR')SHthiohemiacetals
R2C+–CR=CRvinyl carbenes
R2C=hydrocarbylidene groups
R2C=C:vinylidenes
R2C=C+–Rvinylic cations
R2C=C=C=CR2cumulenes
R2C=C=CR2allenes
R2C=C=NRketenimines
R2C=C=Oketenes
R2C=CRC:Rvinyl carbenes
(R2C=N:+)nitrenium ions
R2C=N.iminyl radicals
R2C=N+iminylium ions
R2C=N+(O)Hnitrones
R2C=N+(O)R'nitrones
R2C=N+H2Xonium compounds
R2C=N+R2iminium compounds
R2C=N+R2Yquaternary ammonium compounds
R2C=N+R–CR2ylides
R2C=NNHC(=O)C(=O)NH2semioxamazones
R2C=NNHC(=O)NH2semicarbazones
R2C=NNR2hydrazones
R2C=N–O.iminooxy (iminoxy) radicals
R2C=NOHketoximes
R2C=NOHoximes
R2C=NOR'oxime O-ethers
R2C=NR'ketimines
R2C=NR'Schiff bases (Schiff's bases)
R2C=Oketones
R2C=O+–Yoxonium ylides
R2C=Sthioketones
R2C=S=Othioketone S-oxides
R2C=Seselones
R2C=SO2sulfenes
R2CH–O.ketyls
R2CMLnmetal–carbene complexes
R2C–O.ketyls
R2Calkylidynes
R2Ccarbene radical anions
R2Ge:carbene analogues
R2Ge:germylidenes
R2MgGrignard reagents
(R2N:+)nitrenium ions
R2N.aminyl radicals
R2N.+–Oaminoxyl radicals
(R2N)4Cortho amides
R2N[CH=CH]nCH=N+R2cyanine dyes
R2N+=CH[CH=CH]nNR2cyanine dyes
R2NC(=O)OHurethanes (urethans)
R2NC(=O)OR'urethanes (urethans)
R2NCR=CR2enamines
R2NNOnitrosamines
R2N–Oaminoxides
R2N–O.aminoxyl radicals
R2N–OHaminoxides
R2Omoiety
R2O+–CR2oxonium ylides
R2Pb:carbene analogues
R2Pb:plumbylidenes
R2PHphosphines
R2POHamides
R2S(=O)=NRsulfoximides
R2S=Osulfoxides
R2SbHstibines
R2Se(=O)2selenones
R2Se=Oselenoxides
R2Si:carbene analogues
R2Sn:carbene analogues
R2Sn:stannylidenes
R2Te(=O)2tellurones
R2X+halonium ions
R2Z+–NRimides
R3E, Z
R3Asarsines
R3Bibismuthines
R3C–C(Y)=Xbisecting conformation (eclipsing conformation)
R3Namine imides
R3N+–CR2ylides
R3Pphosphines
R3P+–CR2phosphonium ylides
R3P+–Ophosphine oxides
R3P=CR2phosphonium ylides
R3P=Ophosphine oxides
R3S+sulfonium compounds
R3Sbstibines
R3Si–silyl groups
R3Si.silyl radicals
R3SiC(=O)Rketones
R3SiOHsilanols
R3SiORethers
R3Y+–NRimides
R4E, Z
[R4As]+Xarsonium compounds
R4P.phosphoranyl radicals
[R4P+]Xphosphonium compounds
[R4Sb]+Xstibonium compounds
R–Asarsanylidenes
RAs:carbene analogues
RAsH2arsines
RB:boranylidenes
RB:carbene analogues
RB(OH)2boronic acids
RBiH2bismuthines
R–C:–CH2C(=NR)Rimino carbenes
RC(=NH)–imidoyl carbenes
RC(=NOH)NOnitrosolic acids
RC(=NOH)NO2nitrolic acids
RC(=NR)(OH)imidic acids
RC(=NR)C:–Rimidoyl carbenes
RC(=NR)NRC(=NR)Rdiamidides
[RC(=O)]2NRdiacylamines
RC(=O)Haldehydes
RC(=O)NHNH2hydrazides
RC(=O)NHOHhydroxamic acids
RC(=O)OHoxoacids
RC(=O)SHthiocarboxylic acids
RC(=S)Hthioaldehydes
RC(=S)OHthiocarboxylic acids
RC(=S)SHthiocarboxylic acids
RC(=S=O)Hthioaldehyde S-oxides
RC(NH2)3ortho amides
RC(NHNH2)2=NNH2hydrazidines
RC(OH)=C(OH)C(=O)Rreductones
RC(OH)=NNH2hydrazonic acids
RC(OH)=NOHhydroximic acids
RC(OH)3ortho acids
RC(OR')3ortho esters
RCH=C=Oynols
RCH=NN=CHRaldazines
RCH=NOHaldoximes
RCH=NRaldimines
RCH=NRimines
RCMLnmetal–carbyne complexes
R–C–Rbisecting conformation (eclipsing conformation)
RC≡hydrocarbylidyne groups
R–C≡Cumpolung
'R–C≡C+umpolung
RC≡CHacetylides
RC≡CNR2ynamines
RC≡COHynols
RC≡CRalkynes
R–C≡CXumpolung
RC≡Ncarbonitriles
RC≡Nnitriles
RC≡N+–CR2ylides
RC≡N+N–Rylides
R–C≡N+–Ynitrilium betaines
RC≡NH+onium compounds
RC≡O+onium compounds
RHdiazoamino compounds
RkE(=O)l(OH)macyl groups
RkE(=O)l(OH)macyl species
RkE(=O)l(OH)mamides
RkE(=O)l(OH)manilides
RkE(=O)l(OH)mcyclic acid anhydrides (cyclic anhydrides)
RkE(=O)l(OH)mesters
RkE(=O)l(OH)mhydrazides
RkE(=O)l(OH)mhydrazonic acids
RkE(=O)l(OH)mhydroxamic acids
RkE(=O)l(OH)mhydroximic acids
RkE(=O)l(OH)mimidic acids
RMgXGrignard reagents
RmXylides
RmX+–CR2ylides
RmX+–Yylides
RmX+–YRnylides
RmX=Yylides
RmX=YRnylides
RN:amine imides
RN:carbene analogues
RN+≡Cisocyanides
RN+≡Ndiazonium salts
RN=imides
RN=imino carbenes
RN=C=Oisocyanates
RN=C=Sisothiocyanates
RN=C=Smustard oils
RN=C=Seisoselenocyanates
RN=CR2imines
RN=N.diazenyl radicals
RN=N+diazonium salts
RN=NNHR'diazoamino compounds
RN=N–NR2diazoamino compounds
RN=NOHdiazoates
RN=NOM+diazoates
RN=S(=O)2sulfimides
RN=S(=O)2sulfonylamines
RN=S=Osulfinylamines
RN2−imides
RN2+Ydiazonium salts
RNCisocyanides
R–NCOesters
RnE(=O)OHamidines
RnE(NR2)mamides
RnE(OH)mamides
RNHNOnitrosamines
Rosteric effect
RO–glycosides
(RO)3Si–CH=CH2chemical functionality
(RO)aSi(B)b(C)c(D)dorganically modified silica
RO+oxenium ions
RO+oxylium ions
ROC(=S)SHxanthic acids
ROCNesters
ROHalkoxides
ROMalkoxides
RON=C:fulminates
RO–NOBarton reaction
ROOHhydroperoxides
ROOOR'trioxides
ROORperoxides
RORethers
RoYsteric effect
RP:carbene analogues
RP:phosphanylidenes
RP(=O)(NHNH2)2hydrazides
RP(=O)(OH)2oxoacids
RPH2phosphines
RS–glycosides
RS–sulfenyl groups
RS.sulfenyl radicals
RS(=NH)2(OH)imidic acids
RS(=NH)2=NH2sulfonamidines
RS(=NR)2Rsulfonediimines
RS(=NR)NR2sulfinamidines
RS(=O)(=NNH2)OHhydrazonic acids
RS(=O)(=NOH)OHhydroximic acids
RS(=O)=NH2sulfonamidines
RS(=O)2NHC(=O)Rdiacylamines
RS(=O)2NHNH2hydrazides
RS(=O)2NR'2sulfonamides
RS(=O)2OS(=O)2R'sulfonic anhydrides
RS(=O)2Rsulfones
RS(=O)NR2sulfinamides
RS(=O)OHsulfinamides
RS(=O)OHsulfinamidines
RS(=O)OS(=O)Rsulfinic anhydrides
RS+sulfenylium ions
RS2Hhydropolysulfides
RS2Rpolysulfides
RS3Hhydropolysulfides
RSb:carbene analogues
RSb:stibanylidenes
RSbH2stibines
RSe–glycosides
RSe(=O)2OHselenonic acids
RSe(=O)OHseleninic acids
RSeHselenols
RSeOHselenenic acids
RSeRselenides
RSHthiols
RSnHhydropolysulfides
RSOHamides
RSOHsulfenamides
RSOHsulfenic acids
RSRsulfides
RSRthioethers
RTeRtellurides
RXcommon-ion effect (on rates)
RYsteric effect
SbnHn+2stibanes
(SiH)2n(NH)3nsilasesquiazanes
(SiH)2nO3nsilasesquioxanes
(SiH)2nS3nsilasesquithianes
SinH2n+1OHsilanols
SinH2n+2silanes
Smsemiconductor-metal transition
Sm2+S2−valence transition
(Sm3++e)S2−valence transition
SmSsemiconductor-metal transition
Snhydropolysulfides
ThO2solute-volatilization interference in flame spectroscopy
[TS]kinetic isotope effect
Xbisecting conformation (eclipsing conformation)
Xcharge-transfer reaction in mass spectrometry
Xcross-conjugation
Xdipolar compounds
Xdual substituent-parameter equation
Xextended Hammett equation
Xextrusion transformation
Xhalonium ions
XHammett equation (Hammett relation)
Xinsertion
Xisostructural reaction
Xphosphonitriles
Xprotonated molecule in mass spectrometry
Xumpolung
Xcommon-ion effect (on rates)
X:–C=Zdipolar compounds
X'telomerization
X''telomerization
X+common-ion effect (on rates)
X+ion pair
X+ylides
X+=C–Zdipolar compounds
X+Yion pair
X+–Y–Zdipolar compounds
X=N+=Zdipolar compounds
X=N–Z+dipolar compounds
X=Y+–Zdipolar compounds
X=Y–Z+dipolar compounds
X2excimer lamp
X2pseudohalogens
[X2PN]nphosphonitriles
Xabc2pro-R, pro-S
(XC2H2C2H2)2NRmustards
(XC2H2C2H2)2Smustards
XC6H4GYcross-conjugation
XC6H4YHammett equation (Hammett relation)
XH+protonated molecule in mass spectrometry
X–N=Zdipolar compounds
X–Y+=Zdipolar compounds
XZinsertion
X≡N+–Zdipolar compounds
Ydipolar compounds
Yextrusion transformation
Yimides
Yinsertion
Ysteric effect
Yylides
Yion pair
Yylides
YBa2Cu3O7-xsuperconducting transition
Zdipolar compounds
Zextrusion transformation
Zimides
Zinsertion
Zion pair return
Z=X+–YRnylides
Z–X+=YRnylides
αsyntectic reaction
picture